C16H35N — CID 134314254
N-tert-butyl-3,3,7,7-tetramethyloctan-1-amine (PubChem CID 134314254) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is N-tert-butyl-3,3,7,7-tetramethyloctan-1-amine.
| Compound Name | N-tert-butyl-3,3,7,7-tetramethyloctan-1-amine |
|---|---|
| PubChem CID | 134314254 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | N-tert-butyl-3,3,7,7-tetramethyloctan-1-amine |
| SMILES | CC(C)(C)CCCC(C)(C)CCNC(C)(C)C |
| InChI | InChI=1S/C16H35N/c1-14(2,3)10-9-11-16(7,8)12-13-17-15(4,5)6/h17H,9-13H2,1-8H3 |
| InChIKey | UNCKEINIWUEBIW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |