C48H79NO4 — CID 134314271
[2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-phenylmethoxymethanol (PubChem CID 134314271) has the molecular formula C48H79NO4 and a molecular weight of 734.16 g/mol. Its IUPAC name is [2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-phenylmethoxymethanol.
| Compound Name | [2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-phenylmethoxymethanol |
|---|---|
| PubChem CID | 134314271 |
| Molecular Formula | C48H79NO4 |
| Molecular Weight | 734.16 g/mol |
| Exact Mass | 733.60 |
| IUPAC Name | [2,3-bis[(8Z,11Z)-heptadeca-8,11-dienyl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]-phenylmethoxymethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1OC2(CCN(C(O)OCc3ccccc3)C2)OC1CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C48H79NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-38-45-46(39-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)53-48(52-45)40-41-49(43-48)47(50)51-42-44-36-32-31-33-37-44/h11-14,17-20,31-33,36-37,45-47,50H,3-10,15-16,21-30,34-35,38-43H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | RMGUAWLIJZCQGE-MAZCIEHSSA-N |
| XLogP | 13.29 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.16 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|