About 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine
1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine (PubChem CID 134314321) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine |
| PubChem CID | 134314321 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine |
| SMILES | CC(C)CC1C=CN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25N/c1-11(2)10-12-6-8-14(9-7-12)13(3,4)5/h6,8,11-12H,7,9-10H2,1-5H3 |
| InChIKey | UASOXQATAAFHOW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine (CID 134314321) is 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine is CC(C)CC1C=CN(C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine?
The InChIKey is UASOXQATAAFHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-11(2)10-12-6-8-14(9-7-12)13(3,4)5/h6,8,11-12H,7,9-10H2,1-5H3.
What are the key properties of 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine?
1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine has a molecular weight of 195.35 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(2-methylpropyl)-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 134314321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).