C13H17N3O6 — CID 134314655
(3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl methyl carbonate (PubChem CID 134314655) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl methyl carbonate.
| Compound Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 134314655 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl methyl carbonate |
| SMILES | CCCN1CCn2ncc(=O)c(OCOC(=O)OC)c2C1=O |
| InChI | InChI=1S/C13H17N3O6/c1-3-4-15-5-6-16-10(12(15)18)11(9(17)7-14-16)21-8-22-13(19)20-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | FGIQAAZZFXCLME-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|