C25H36N4 — CID 134315124
4-[2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-3,3-dimethylcyclohexen-1-yl]piperidine (PubChem CID 134315124) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-[2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-3,3-dimethylcyclohexen-1-yl]piperidine.
| Compound Name | 4-[2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-3,3-dimethylcyclohexen-1-yl]piperidine |
|---|---|
| PubChem CID | 134315124 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-[2-[(1E,3E,5E,7E)-3,7-dimethyl-8-(1H-1,2,4-triazol-5-yl)octa-1,3,5,7-tetraenyl]-3,3-dimethylcyclohexen-1-yl]piperidine |
| SMILES | CC(/C=C/C1=C(C2CCNCC2)CCCC1(C)C)=C\C=C\C(C)=C\c1ncn[nH]1 |
| InChI | InChI=1S/C25H36N4/c1-19(7-5-8-20(2)17-24-27-18-28-29-24)10-11-23-22(9-6-14-25(23,3)4)21-12-15-26-16-13-21/h5,7-8,10-11,17-18,21,26H,6,9,12-16H2,1-4H3,(H,27,28,29)/b8-5+,11-10+,19-7+,20-17+ |
| InChIKey | NOSOSOHQWQRWAC-OJVIHJPISA-N |
| XLogP | 5.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|