C30H51FN2 — CID 134315682
(Z)-1-N-[(4E,6Z)-4-ethyl-3-propyldeca-4,6-dienyl]-1-N'-[(2E,5E,7E)-6-fluorodeca-2,5,7-trienyl]-1-N,1-N'-dimethylprop-1-ene-1,1-diamine (PubChem CID 134315682) has the molecular formula C30H51FN2 and a molecular weight of 458.75 g/mol. Its IUPAC name is (Z)-1-N-[(4E,6Z)-4-ethyl-3-propyldeca-4,6-dienyl]-1-N'-[(2E,5E,7E)-6-fluorodeca-2,5,7-trienyl]-1-N,1-N'-dimethylprop-1-ene-1,1-diamine.
| Compound Name | (Z)-1-N-[(4E,6Z)-4-ethyl-3-propyldeca-4,6-dienyl]-1-N'-[(2E,5E,7E)-6-fluorodeca-2,5,7-trienyl]-1-N,1-N'-dimethylprop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 134315682 |
| Molecular Formula | C30H51FN2 |
| Molecular Weight | 458.75 g/mol |
| Exact Mass | 458.40 |
| IUPAC Name | (Z)-1-N-[(4E,6Z)-4-ethyl-3-propyldeca-4,6-dienyl]-1-N'-[(2E,5E,7E)-6-fluorodeca-2,5,7-trienyl]-1-N,1-N'-dimethylprop-1-ene-1,1-diamine |
| SMILES | C/C=C(\N(C)C/C=C/C/C=C(F)\C=C\CC)N(C)CCC(CCC)/C(=C/C=C\CCC)CC |
| InChI | InChI=1S/C30H51FN2/c1-8-13-15-17-21-27(11-4)28(20-10-3)24-26-33(7)30(12-5)32(6)25-19-16-18-23-29(31)22-14-9-2/h12,14-17,19,21-23,28H,8-11,13,18,20,24-26H2,1-7H3/b17-15-,19-16+,22-14+,27-21+,29-23+,30-12+ |
| InChIKey | BCCQYSAUIQKSGY-UTXVWYBCSA-N |
| XLogP | 8.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.75 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|