C9H9F7O — CID 13431587
2-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexan-1-one (PubChem CID 13431587) has the molecular formula C9H9F7O and a molecular weight of 266.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexan-1-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 13431587 |
| Molecular Formula | C9H9F7O |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)cyclohexan-1-one |
| SMILES | O=C1CCCCC1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F7O/c10-7(11,8(12,13)9(14,15)16)5-3-1-2-4-6(5)17/h5H,1-4H2 |
| InChIKey | GIKZDAQXHSEHMI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|