C15H21N5O — CID 134315911
5-[3-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1,2-dihydroimidazol-2-yl]-1,3-dimethylpyridin-2-one (PubChem CID 134315911) has the molecular formula C15H21N5O and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-[3-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1,2-dihydroimidazol-2-yl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[3-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1,2-dihydroimidazol-2-yl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 134315911 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 5-[3-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-1,2-dihydroimidazol-2-yl]-1,3-dimethylpyridin-2-one |
| SMILES | CC1=CC(=CN(C1=O)C)C2NC=CN2C/C(=C/C=C\N)/N |
| InChI | InChI=1S/C15H21N5O/c1-11-8-12(9-19(2)15(11)21)14-18-6-7-20(14)10-13(17)4-3-5-16/h3-9,14,18H,10,16-17H2,1-2H3/b5-3-,13-4- |
| InChIKey | RRMFZJLMUCWUKC-FCTXBAKWSA-N |
| XLogP | -0.20 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | 571 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|