About 9-iodo-1-methylcarbazole
9-iodo-1-methylcarbazole (PubChem CID 134316149) has the molecular formula C13H10IN
and a molecular weight of 307.13 g/mol. Its IUPAC name is 9-iodo-1-methylcarbazole.
Molecular Properties
| Compound Name | 9-iodo-1-methylcarbazole |
| PubChem CID | 134316149 |
| Molecular Formula | C13H10IN |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 9-iodo-1-methylcarbazole |
| SMILES | Cc1cccc2c3ccccc3n(I)c12 |
| InChI | InChI=1S/C13H10IN/c1-9-5-4-7-11-10-6-2-3-8-12(10)15(14)13(9)11/h2-8H,1H3 |
| InChIKey | YDIZUMUNECZXDH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-1-methylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-1-methylcarbazole?
The IUPAC name of 9-iodo-1-methylcarbazole (CID 134316149) is 9-iodo-1-methylcarbazole.
What is the SMILES notation for 9-iodo-1-methylcarbazole?
The canonical SMILES for 9-iodo-1-methylcarbazole is Cc1cccc2c3ccccc3n(I)c12.
What is the InChIKey of 9-iodo-1-methylcarbazole?
The InChIKey is YDIZUMUNECZXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10IN/c1-9-5-4-7-11-10-6-2-3-8-12(10)15(14)13(9)11/h2-8H,1H3.
What are the key properties of 9-iodo-1-methylcarbazole?
9-iodo-1-methylcarbazole has a molecular weight of 307.13 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-1-methylcarbazole is sourced from PubChem (CID 134316149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).