C16H21N3 — CID 134316347
(Z)-N-methyl-1-(6-methyl-2-phenyl-1,2,5,6-tetrahydropyrimidin-4-yl)but-2-en-1-imine (PubChem CID 134316347) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is (Z)-N-methyl-1-(6-methyl-2-phenyl-1,2,5,6-tetrahydropyrimidin-4-yl)but-2-en-1-imine.
| Compound Name | (Z)-N-methyl-1-(6-methyl-2-phenyl-1,2,5,6-tetrahydropyrimidin-4-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 134316347 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (Z)-N-methyl-1-(6-methyl-2-phenyl-1,2,5,6-tetrahydropyrimidin-4-yl)but-2-en-1-imine |
| SMILES | C/C=C\C(=N/C)C1=NC(c2ccccc2)NC(C)C1 |
| InChI | InChI=1S/C16H21N3/c1-4-8-14(17-3)15-11-12(2)18-16(19-15)13-9-6-5-7-10-13/h4-10,12,16,18H,11H2,1-3H3/b8-4-,17-14+ |
| InChIKey | QIRXPELBXNYOBK-ZCCRCURRSA-N |
| XLogP | 3.15 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|