About 3-methyl-1,2,4a,8a-tetrahydroquinoxaline
3-methyl-1,2,4a,8a-tetrahydroquinoxaline (PubChem CID 134316351) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-methyl-1,2,4a,8a-tetrahydroquinoxaline.
Molecular Properties
| Compound Name | 3-methyl-1,2,4a,8a-tetrahydroquinoxaline |
| PubChem CID | 134316351 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-methyl-1,2,4a,8a-tetrahydroquinoxaline |
| SMILES | CC1=NC2C=CC=CC2NC1 |
| InChI | InChI=1S/C9H12N2/c1-7-6-10-8-4-2-3-5-9(8)11-7/h2-5,8-10H,6H2,1H3 |
| InChIKey | OCXWOJCVKDZKHD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1,2,4a,8a-tetrahydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2,4a,8a-tetrahydroquinoxaline?
The IUPAC name of 3-methyl-1,2,4a,8a-tetrahydroquinoxaline (CID 134316351) is 3-methyl-1,2,4a,8a-tetrahydroquinoxaline.
What is the SMILES notation for 3-methyl-1,2,4a,8a-tetrahydroquinoxaline?
The canonical SMILES for 3-methyl-1,2,4a,8a-tetrahydroquinoxaline is CC1=NC2C=CC=CC2NC1.
What is the InChIKey of 3-methyl-1,2,4a,8a-tetrahydroquinoxaline?
The InChIKey is OCXWOJCVKDZKHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-6-10-8-4-2-3-5-9(8)11-7/h2-5,8-10H,6H2,1H3.
What are the key properties of 3-methyl-1,2,4a,8a-tetrahydroquinoxaline?
3-methyl-1,2,4a,8a-tetrahydroquinoxaline has a molecular weight of 148.21 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2,4a,8a-tetrahydroquinoxaline is sourced from PubChem (CID 134316351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).