About N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine
N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine (PubChem CID 134316533) has the molecular formula C5H8IN3
and a molecular weight of 237.04 g/mol. Its IUPAC name is N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine.
Molecular Properties
| Compound Name | N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine |
| PubChem CID | 134316533 |
| Molecular Formula | C5H8IN3 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine |
| SMILES | CC1C=CNC(NI)=N1 |
| InChI | InChI=1S/C5H8IN3/c1-4-2-3-7-5(8-4)9-6/h2-4H,1H3,(H2,7,8,9) |
| InChIKey | NBSWPXXGIFQLRY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine?
The IUPAC name of N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine (CID 134316533) is N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine.
What is the SMILES notation for N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine?
The canonical SMILES for N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine is CC1C=CNC(NI)=N1.
What is the InChIKey of N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine?
The InChIKey is NBSWPXXGIFQLRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8IN3/c1-4-2-3-7-5(8-4)9-6/h2-4H,1H3,(H2,7,8,9).
What are the key properties of N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine?
N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine has a molecular weight of 237.04 g/mol, XLogP of 0.79, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-4-methyl-1,4-dihydropyrimidin-2-amine is sourced from PubChem (CID 134316533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).