C17H26FN — CID 134316547
1-fluoro-3-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclohexa-1,5-dien-1-yl]pentan-2-amine (PubChem CID 134316547) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is 1-fluoro-3-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclohexa-1,5-dien-1-yl]pentan-2-amine.
| Compound Name | 1-fluoro-3-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclohexa-1,5-dien-1-yl]pentan-2-amine |
|---|---|
| PubChem CID | 134316547 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-fluoro-3-[4-[(2E,4Z)-hexa-2,4-dien-2-yl]cyclohexa-1,5-dien-1-yl]pentan-2-amine |
| SMILES | C/C=C\C=C(/C)C1C=CC(C(CC)C(N)CF)=CC1 |
| InChI | InChI=1S/C17H26FN/c1-4-6-7-13(3)14-8-10-15(11-9-14)16(5-2)17(19)12-18/h4,6-8,10-11,14,16-17H,5,9,12,19H2,1-3H3/b6-4-,13-7+ |
| InChIKey | KHVNOWUGXMZYEH-FMEHWCPISA-N |
| XLogP | 4.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|