About 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene
3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene (PubChem CID 134316942) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene.
Molecular Properties
| Compound Name | 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene |
| PubChem CID | 134316942 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene |
| SMILES | CC1C2CC3C=NC=C(C3)C12 |
| InChI | InChI=1S/C10H13N/c1-6-9-3-7-2-8(10(6)9)5-11-4-7/h4-7,9-10H,2-3H2,1H3 |
| InChIKey | QYDALTZSSULWSL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene?
The IUPAC name of 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene (CID 134316942) is 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene.
What is the SMILES notation for 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene?
The canonical SMILES for 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene is CC1C2CC3C=NC=C(C3)C12.
What is the InChIKey of 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene?
The InChIKey is QYDALTZSSULWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-6-9-3-7-2-8(10(6)9)5-11-4-7/h4-7,9-10H,2-3H2,1H3.
What are the key properties of 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene?
3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene has a molecular weight of 147.22 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8-azatricyclo[4.3.1.02,4]deca-1(9),7-diene is sourced from PubChem (CID 134316942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).