C30H17Cl2N2O2P — CID 134317345
5,11-dichloro-14,22-diphenyl-8-oxa-14,22-diaza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide (PubChem CID 134317345) has the molecular formula C30H17Cl2N2O2P and a molecular weight of 539.36 g/mol. Its IUPAC name is 5,11-dichloro-14,22-diphenyl-8-oxa-14,22-diaza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide.
| Compound Name | 5,11-dichloro-14,22-diphenyl-8-oxa-14,22-diaza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide |
|---|---|
| PubChem CID | 134317345 |
| Molecular Formula | C30H17Cl2N2O2P |
| Molecular Weight | 539.36 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 5,11-dichloro-14,22-diphenyl-8-oxa-14,22-diaza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene 1-oxide |
| SMILES | O=P12c3c4cc(Cl)cc3N(c3ccccc3)c3cccc(c31)N(c1ccccc1)c1cc(Cl)cc(c12)O4 |
| InChI | InChI=1S/C30H17Cl2N2O2P/c31-18-14-24-29-26(16-18)36-27-17-19(32)15-25-30(27)37(29,35)28-22(33(24)20-8-3-1-4-9-20)12-7-13-23(28)34(25)21-10-5-2-6-11-21/h1-17H |
| InChIKey | OCLDIHBVITYTJA-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.36 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|