C38H35N2O3P — CID 134317476
22-tert-butyl-11,17-dimethyl-N,N-bis(4-methylphenyl)-1-oxo-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-5-amine (PubChem CID 134317476) has the molecular formula C38H35N2O3P and a molecular weight of 598.68 g/mol. Its IUPAC name is 22-tert-butyl-11,17-dimethyl-N,N-bis(4-methylphenyl)-1-oxo-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-5-amine.
| Compound Name | 22-tert-butyl-11,17-dimethyl-N,N-bis(4-methylphenyl)-1-oxo-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-5-amine |
|---|---|
| PubChem CID | 134317476 |
| Molecular Formula | C38H35N2O3P |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 22-tert-butyl-11,17-dimethyl-N,N-bis(4-methylphenyl)-1-oxo-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaen-5-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc3c4c(c2)N(C(C)(C)C)c2cc(C)cc5c2P4(=O)c2c(cc(C)cc2O3)O5)cc1 |
| InChI | InChI=1S/C38H35N2O3P/c1-22-8-12-26(13-9-22)39(27-14-10-23(2)11-15-27)28-20-30-36-34(21-28)43-33-19-25(4)18-32-37(33)44(36,41)35-29(40(30)38(5,6)7)16-24(3)17-31(35)42-32/h8-21H,1-7H3 |
| InChIKey | OSFYJBBOKYMIIV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|