About 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine
3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine (PubChem CID 134317602) has the molecular formula C10H8ClF3N4
and a molecular weight of 276.65 g/mol. Its IUPAC name is 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine |
| PubChem CID | 134317602 |
| Molecular Formula | C10H8ClF3N4 |
| Molecular Weight | 276.65 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccn(CC(F)(F)F)n2)cc1Cl |
| InChI | InChI=1S/C10H8ClF3N4/c11-7-3-6(4-16-9(7)15)8-1-2-18(17-8)5-10(12,13)14/h1-4H,5H2,(H2,15,16) |
| InChIKey | HZIVRHPBMPKPEH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine?
The IUPAC name of 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine (CID 134317602) is 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine.
What is the SMILES notation for 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine?
The canonical SMILES for 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine is Nc1ncc(-c2ccn(CC(F)(F)F)n2)cc1Cl.
What is the InChIKey of 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine?
The InChIKey is HZIVRHPBMPKPEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClF3N4/c11-7-3-6(4-16-9(7)15)8-1-2-18(17-8)5-10(12,13)14/h1-4H,5H2,(H2,15,16).
What are the key properties of 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine?
3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine has a molecular weight of 276.65 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridin-2-amine is sourced from PubChem (CID 134317602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).