C8H10N4 — CID 134317973
2,6,8-trimethyl-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 134317973) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,6,8-trimethyl-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 2,6,8-trimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 134317973 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,6,8-trimethyl-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1cn2nc(C)nc2c(C)n1 |
| InChI | InChI=1S/C8H10N4/c1-5-4-12-8(6(2)9-5)10-7(3)11-12/h4H,1-3H3 |
| InChIKey | GZHWQDJPKMNRRH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |