C20H44O13P2 — CID 134318658
2-[2-[2-[2-[2-[2-[hydroxy(pentan-3-yloxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl propyl hydrogen phosphate (PubChem CID 134318658) has the molecular formula C20H44O13P2 and a molecular weight of 554.51 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[hydroxy(pentan-3-yloxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl propyl hydrogen phosphate.
| Compound Name | 2-[2-[2-[2-[2-[2-[hydroxy(pentan-3-yloxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl propyl hydrogen phosphate |
|---|---|
| PubChem CID | 134318658 |
| Molecular Formula | C20H44O13P2 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[hydroxy(pentan-3-yloxy)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl propyl hydrogen phosphate |
| SMILES | CCCOP(=O)(O)OCCOCCOCCOCCOCCOCCOP(=O)(O)OC(CC)CC |
| InChI | InChI=1S/C20H44O13P2/c1-4-7-30-34(21,22)31-18-16-28-14-12-26-10-8-25-9-11-27-13-15-29-17-19-32-35(23,24)33-20(5-2)6-3/h20H,4-19H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | DGGYBJSYUXWZRM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|