C13H5F7N2O2 — CID 134318670
2-oxo-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 134318670) has the molecular formula C13H5F7N2O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is 2-oxo-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134318670 |
| Molecular Formula | C13H5F7N2O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-oxo-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1ccc[nH]c1=O |
| InChI | InChI=1S/C13H5F7N2O2/c14-6-5(13(18,19)20)7(15)9(17)10(8(6)16)22-12(24)4-2-1-3-21-11(4)23/h1-3H,(H,21,23)(H,22,24) |
| InChIKey | VEQVUAPNNHHYBB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|