C22H30O4 — CID 134318695
[(1R,9S)-1-[(1E,5E)-7-hydroxy-2,6-dimethylhepta-1,5-dienyl]-3,6-dimethylidene-2-oxaspiro[4.5]dec-7-en-9-yl] acetate (PubChem CID 134318695) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1R,9S)-1-[(1E,5E)-7-hydroxy-2,6-dimethylhepta-1,5-dienyl]-3,6-dimethylidene-2-oxaspiro[4.5]dec-7-en-9-yl] acetate.
| Compound Name | [(1R,9S)-1-[(1E,5E)-7-hydroxy-2,6-dimethylhepta-1,5-dienyl]-3,6-dimethylidene-2-oxaspiro[4.5]dec-7-en-9-yl] acetate |
|---|---|
| PubChem CID | 134318695 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1R,9S)-1-[(1E,5E)-7-hydroxy-2,6-dimethylhepta-1,5-dienyl]-3,6-dimethylidene-2-oxaspiro[4.5]dec-7-en-9-yl] acetate |
| SMILES | C=C1CC2(C[C@H](OC(C)=O)C=CC2=C)[C@@H](/C=C(\C)CC/C=C(\C)CO)O1 |
| InChI | InChI=1S/C22H30O4/c1-15(7-6-8-16(2)14-23)11-21-22(12-18(4)25-21)13-20(26-19(5)24)10-9-17(22)3/h8-11,20-21,23H,3-4,6-7,12-14H2,1-2,5H3/b15-11+,16-8+/t20-,21-,22?/m1/s1 |
| InChIKey | LFGXRUWIRYVIKF-IXENEHQESA-N |
| XLogP | 4.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|