About (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate
(5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate (PubChem CID 134318866) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 134318866 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1ncc(C=O)s1 |
| InChI | InChI=1S/C10H13NO3S/c1-10(2,3)9(13)14-6-8-11-4-7(5-12)15-8/h4-5H,6H2,1-3H3 |
| InChIKey | MXOWSKXSOIIQRW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate (CID 134318866) is (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCc1ncc(C=O)s1.
What is the InChIKey of (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate?
The InChIKey is MXOWSKXSOIIQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-10(2,3)9(13)14-6-8-11-4-7(5-12)15-8/h4-5H,6H2,1-3H3.
What are the key properties of (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate?
(5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate has a molecular weight of 227.28 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formyl-1,3-thiazol-2-yl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 134318866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).