C22H35N3 — CID 134318959
(3Z)-2-N-(1-aminobut-3-enyl)-3-N-[(1Z,5Z)-7-methylocta-1,5,7-trienyl]-2-N-propylhexa-1,3,5-triene-2,3-diamine (PubChem CID 134318959) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (3Z)-2-N-(1-aminobut-3-enyl)-3-N-[(1Z,5Z)-7-methylocta-1,5,7-trienyl]-2-N-propylhexa-1,3,5-triene-2,3-diamine.
| Compound Name | (3Z)-2-N-(1-aminobut-3-enyl)-3-N-[(1Z,5Z)-7-methylocta-1,5,7-trienyl]-2-N-propylhexa-1,3,5-triene-2,3-diamine |
|---|---|
| PubChem CID | 134318959 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | (3Z)-2-N-(1-aminobut-3-enyl)-3-N-[(1Z,5Z)-7-methylocta-1,5,7-trienyl]-2-N-propylhexa-1,3,5-triene-2,3-diamine |
| SMILES | C=C/C=C(\N/C=C\CC/C=C\C(=C)C)C(=C)N(CCC)C(N)CC=C |
| InChI | InChI=1S/C22H35N3/c1-7-14-21(24-17-13-11-10-12-16-19(4)5)20(6)25(18-9-3)22(23)15-8-2/h7-8,12-14,16-17,22,24H,1-2,4,6,9-11,15,18,23H2,3,5H3/b16-12-,17-13-,21-14- |
| InChIKey | PSHMTANIVLODTQ-OZTQYPKUSA-N |
| XLogP | 5.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|