C19H32O3 — CID 134319322
(3E,4Z,7Z,9R)-4-ethyl-3-(1-hydroxyethylidene)-7-methoxy-9,11-dimethyldodeca-4,7-dienal (PubChem CID 134319322) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (3E,4Z,7Z,9R)-4-ethyl-3-(1-hydroxyethylidene)-7-methoxy-9,11-dimethyldodeca-4,7-dienal.
| Compound Name | (3E,4Z,7Z,9R)-4-ethyl-3-(1-hydroxyethylidene)-7-methoxy-9,11-dimethyldodeca-4,7-dienal |
|---|---|
| PubChem CID | 134319322 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (3E,4Z,7Z,9R)-4-ethyl-3-(1-hydroxyethylidene)-7-methoxy-9,11-dimethyldodeca-4,7-dienal |
| SMILES | CCC(=C/C/C(=C/[C@H](C)CC(C)C)OC)/C(CC=O)=C(\C)O |
| InChI | InChI=1S/C19H32O3/c1-7-17(19(10-11-20)16(5)21)8-9-18(22-6)13-15(4)12-14(2)3/h8,11,13-15,21H,7,9-10,12H2,1-6H3/b17-8-,18-13-,19-16+/t15-/m1/s1 |
| InChIKey | USIGOJLFRWPFRJ-CBCQSITASA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|