About (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane
(6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane (PubChem CID 134319570) has the molecular formula C16H31P
and a molecular weight of 254.40 g/mol. Its IUPAC name is (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane.
Molecular Properties
| Compound Name | (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane |
| PubChem CID | 134319570 |
| Molecular Formula | C16H31P |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane |
| SMILES | CCCC1C(C)C2CC(P)CCC(C)(CC)C12 |
| InChI | InChI=1S/C16H31P/c1-5-7-13-11(3)14-10-12(17)8-9-16(4,6-2)15(13)14/h11-15H,5-10,17H2,1-4H3 |
| InChIKey | FBUWWKZWENVDDQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane?
The IUPAC name of (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane (CID 134319570) is (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane.
What is the SMILES notation for (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane?
The canonical SMILES for (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane is CCCC1C(C)C2CC(P)CCC(C)(CC)C12.
What is the InChIKey of (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane?
The InChIKey is FBUWWKZWENVDDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31P/c1-5-7-13-11(3)14-10-12(17)8-9-16(4,6-2)15(13)14/h11-15H,5-10,17H2,1-4H3.
What are the key properties of (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane?
(6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane has a molecular weight of 254.40 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-6,9-dimethyl-8-propyl-3-bicyclo[5.2.0]nonanyl)phosphane is sourced from PubChem (CID 134319570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).