About 2-(2-propyl-1,3-dioxolan-2-yl)butanal
2-(2-propyl-1,3-dioxolan-2-yl)butanal (PubChem CID 13432065) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(2-propyl-1,3-dioxolan-2-yl)butanal.
Molecular Properties
| Compound Name | 2-(2-propyl-1,3-dioxolan-2-yl)butanal |
| PubChem CID | 13432065 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-(2-propyl-1,3-dioxolan-2-yl)butanal |
| SMILES | CCCC1(C(C=O)CC)OCCO1 |
| InChI | InChI=1S/C10H18O3/c1-3-5-10(9(4-2)8-11)12-6-7-13-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | JSBBQPBYAPNYMH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-propyl-1,3-dioxolan-2-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)butanal?
The IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)butanal (CID 13432065) is 2-(2-propyl-1,3-dioxolan-2-yl)butanal.
What is the SMILES notation for 2-(2-propyl-1,3-dioxolan-2-yl)butanal?
The canonical SMILES for 2-(2-propyl-1,3-dioxolan-2-yl)butanal is CCCC1(C(C=O)CC)OCCO1.
What is the InChIKey of 2-(2-propyl-1,3-dioxolan-2-yl)butanal?
The InChIKey is JSBBQPBYAPNYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-5-10(9(4-2)8-11)12-6-7-13-10/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-(2-propyl-1,3-dioxolan-2-yl)butanal?
2-(2-propyl-1,3-dioxolan-2-yl)butanal has a molecular weight of 186.25 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propyl-1,3-dioxolan-2-yl)butanal is sourced from PubChem (CID 13432065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).