About 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid
3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid (PubChem CID 134320741) has the molecular formula C11H11NO4S
and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid |
| PubChem CID | 134320741 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid |
| SMILES | C=CC(=O)CNC1C#CC=CC(S(=O)(=O)O)=C1 |
| InChI | InChI=1S/C11H11NO4S/c1-2-10(13)8-12-9-5-3-4-6-11(7-9)17(14,15)16/h2,4,6-7,9,12H,1,8H2,(H,14,15,16) |
| InChIKey | KQZUQRXNVGIXFE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid?
The IUPAC name of 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid (CID 134320741) is 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid.
What is the SMILES notation for 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid?
The canonical SMILES for 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid is C=CC(=O)CNC1C#CC=CC(S(=O)(=O)O)=C1.
What is the InChIKey of 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid?
The InChIKey is KQZUQRXNVGIXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4S/c1-2-10(13)8-12-9-5-3-4-6-11(7-9)17(14,15)16/h2,4,6-7,9,12H,1,8H2,(H,14,15,16).
What are the key properties of 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid?
3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid has a molecular weight of 253.28 g/mol, XLogP of 0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxobut-3-enylamino)cyclohepta-1,6-dien-4-yne-1-sulfonic acid is sourced from PubChem (CID 134320741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).