C62H51N — CID 134320887
4-[2-methyl-3-(2-methylphenyl)phenyl]-3-phenyl-N-[(2Z,4E)-4-(4-phenylphenyl)hexa-2,4-dienyl]-N-[4-(4-phenylphenyl)phenyl]aniline (PubChem CID 134320887) has the molecular formula C62H51N and a molecular weight of 810.10 g/mol. Its IUPAC name is 4-[2-methyl-3-(2-methylphenyl)phenyl]-3-phenyl-N-[(2Z,4E)-4-(4-phenylphenyl)hexa-2,4-dienyl]-N-[4-(4-phenylphenyl)phenyl]aniline.
| Compound Name | 4-[2-methyl-3-(2-methylphenyl)phenyl]-3-phenyl-N-[(2Z,4E)-4-(4-phenylphenyl)hexa-2,4-dienyl]-N-[4-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 134320887 |
| Molecular Formula | C62H51N |
| Molecular Weight | 810.10 g/mol |
| Exact Mass | 809.40 |
| IUPAC Name | 4-[2-methyl-3-(2-methylphenyl)phenyl]-3-phenyl-N-[(2Z,4E)-4-(4-phenylphenyl)hexa-2,4-dienyl]-N-[4-(4-phenylphenyl)phenyl]aniline |
| SMILES | C/C=C(\C=C/CN(c1ccc(-c2ccc(-c3ccccc3)cc2)cc1)c1ccc(-c2cccc(-c3ccccc3C)c2C)c(-c2ccccc2)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C62H51N/c1-4-47(50-29-31-51(32-30-50)48-19-8-5-9-20-48)25-17-43-63(56-39-37-54(38-40-56)53-35-33-52(34-36-53)49-21-10-6-11-22-49)57-41-42-61(62(44-57)55-23-12-7-13-24-55)60-28-16-27-59(46(60)3)58-26-15-14-18-45(58)2/h4-42,44H,43H2,1-3H3/b25-17-,47-4+ |
| InChIKey | RUDFXNBJJVJHKF-OOGHQKPMSA-N |
| XLogP | 17.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.10 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|