About O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate
O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate (PubChem CID 134321147) has the molecular formula C8H4ClF3OS
and a molecular weight of 240.63 g/mol. Its IUPAC name is O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate.
Molecular Properties
| Compound Name | O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate |
| PubChem CID | 134321147 |
| Molecular Formula | C8H4ClF3OS |
| Molecular Weight | 240.63 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate |
| SMILES | FCc1cc(OC(=S)Cl)cc(F)c1F |
| InChI | InChI=1S/C8H4ClF3OS/c9-8(14)13-5-1-4(3-10)7(12)6(11)2-5/h1-2H,3H2 |
| InChIKey | IHIBVXHZZCUFFY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate?
The IUPAC name of O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate (CID 134321147) is O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate.
What is the SMILES notation for O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate?
The canonical SMILES for O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate is FCc1cc(OC(=S)Cl)cc(F)c1F.
What is the InChIKey of O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate?
The InChIKey is IHIBVXHZZCUFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF3OS/c9-8(14)13-5-1-4(3-10)7(12)6(11)2-5/h1-2H,3H2.
What are the key properties of O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate?
O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate has a molecular weight of 240.63 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[3,4-difluoro-5-(fluoromethyl)phenyl] chloromethanethioate is sourced from PubChem (CID 134321147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).