C24H25N — CID 134321181
N-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-N-methylnaphthalen-1-amine (PubChem CID 134321181) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-N-methylnaphthalen-1-amine.
| Compound Name | N-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-N-methylnaphthalen-1-amine |
|---|---|
| PubChem CID | 134321181 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-N-methylnaphthalen-1-amine |
| SMILES | C/C=C\C(=C/CC)c1ccc(N(C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H25N/c1-4-9-19(10-5-2)20-15-17-22(18-16-20)25(3)24-14-8-12-21-11-6-7-13-23(21)24/h4,6-18H,5H2,1-3H3/b9-4-,19-10+ |
| InChIKey | YPYPRYLTFZFYER-QFUOUWBRSA-N |
| XLogP | 6.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|