C21H42S — CID 134321306
1-ethyl-1-methyl-2-(3,6,7-trimethyl-6-prop-2-enyldecan-2-yl)thiirane (PubChem CID 134321306) has the molecular formula C21H42S and a molecular weight of 326.63 g/mol. Its IUPAC name is 1-ethyl-1-methyl-2-(3,6,7-trimethyl-6-prop-2-enyldecan-2-yl)thiirane.
| Compound Name | 1-ethyl-1-methyl-2-(3,6,7-trimethyl-6-prop-2-enyldecan-2-yl)thiirane |
|---|---|
| PubChem CID | 134321306 |
| Molecular Formula | C21H42S |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | 1-ethyl-1-methyl-2-(3,6,7-trimethyl-6-prop-2-enyldecan-2-yl)thiirane |
| SMILES | C=CCC(C)(CCC(C)C(C)C1CS1(C)CC)C(C)CCC |
| InChI | InChI=1S/C21H42S/c1-9-12-18(5)21(7,14-10-2)15-13-17(4)19(6)20-16-22(20,8)11-3/h10,17-20H,2,9,11-16H2,1,3-8H3 |
| InChIKey | RNBZOWUSULNKFP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|