C31H58ClN9O — CID 134321530
N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-3,3-diamino-2-(3-chloro-6-methyl-6-pentyl-2,3,4,5-tetrahydroazepin-7-yl)propanamide (PubChem CID 134321530) has the molecular formula C31H58ClN9O and a molecular weight of 608.32 g/mol. Its IUPAC name is N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-3,3-diamino-2-(3-chloro-6-methyl-6-pentyl-2,3,4,5-tetrahydroazepin-7-yl)propanamide.
| Compound Name | N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-3,3-diamino-2-(3-chloro-6-methyl-6-pentyl-2,3,4,5-tetrahydroazepin-7-yl)propanamide |
|---|---|
| PubChem CID | 134321530 |
| Molecular Formula | C31H58ClN9O |
| Molecular Weight | 608.32 g/mol |
| Exact Mass | 607.45 |
| IUPAC Name | N-[4-[4-(2,3,5,6,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-7-yl)piperidin-1-yl]piperidin-3-yl]-3,3-diamino-2-(3-chloro-6-methyl-6-pentyl-2,3,4,5-tetrahydroazepin-7-yl)propanamide |
| SMILES | CCCCCC1(C)CCC(Cl)CN=C1C(C(=O)NC1CNCCC1N1CCC(N2CCN3CNCC3C2)CC1)C(N)N |
| InChI | InChI=1S/C31H58ClN9O/c1-3-4-5-10-31(2)11-6-22(32)17-37-28(31)27(29(33)34)30(42)38-25-19-35-12-7-26(25)39-13-8-23(9-14-39)40-15-16-41-21-36-18-24(41)20-40/h22-27,29,35-36H,3-21,33-34H2,1-2H3,(H,38,42) |
| InChIKey | JHENFPRJOVMERZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|