About 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine
5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine (PubChem CID 134321534) has the molecular formula C16H31N3
and a molecular weight of 265.44 g/mol. Its IUPAC name is 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine |
| PubChem CID | 134321534 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine |
| SMILES | CC1(C)CCCN1C1C(N)CNCC1C1CCCC1 |
| InChI | InChI=1S/C16H31N3/c1-16(2)8-5-9-19(16)15-13(10-18-11-14(15)17)12-6-3-4-7-12/h12-15,18H,3-11,17H2,1-2H3 |
| InChIKey | IQYSZVKATKKKQO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine?
The IUPAC name of 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine (CID 134321534) is 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine.
What is the SMILES notation for 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine?
The canonical SMILES for 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine is CC1(C)CCCN1C1C(N)CNCC1C1CCCC1.
What is the InChIKey of 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine?
The InChIKey is IQYSZVKATKKKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3/c1-16(2)8-5-9-19(16)15-13(10-18-11-14(15)17)12-6-3-4-7-12/h12-15,18H,3-11,17H2,1-2H3.
What are the key properties of 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine?
5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine has a molecular weight of 265.44 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-4-(2,2-dimethylpyrrolidin-1-yl)piperidin-3-amine is sourced from PubChem (CID 134321534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).