C20H20Cl2N4O2 — CID 134321604
6-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(3S)-pyrrolidin-3-yl]quinazolin-2-amine (PubChem CID 134321604) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(3S)-pyrrolidin-3-yl]quinazolin-2-amine.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(3S)-pyrrolidin-3-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 134321604 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(3S)-pyrrolidin-3-yl]quinazolin-2-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3nc(N[C@H]4CCNC4)ncc3c2)c1Cl |
| InChI | InChI=1S/C20H20Cl2N4O2/c1-27-15-8-16(28-2)19(22)17(18(15)21)11-3-4-14-12(7-11)9-24-20(26-14)25-13-5-6-23-10-13/h3-4,7-9,13,23H,5-6,10H2,1-2H3,(H,24,25,26)/t13-/m0/s1 |
| InChIKey | IUANGHPZIGWOLW-ZDUSSCGKSA-N |
| XLogP | 4.39 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |