C31H58FN7O2 — CID 134321829
3,3-diamino-N-[5-butyl-4-[4-(oxan-4-yl)piperazin-1-yl]piperidin-3-yl]-2-[(4R)-4-ethyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanamide (PubChem CID 134321829) has the molecular formula C31H58FN7O2 and a molecular weight of 579.85 g/mol. Its IUPAC name is 3,3-diamino-N-[5-butyl-4-[4-(oxan-4-yl)piperazin-1-yl]piperidin-3-yl]-2-[(4R)-4-ethyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanamide.
| Compound Name | 3,3-diamino-N-[5-butyl-4-[4-(oxan-4-yl)piperazin-1-yl]piperidin-3-yl]-2-[(4R)-4-ethyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanamide |
|---|---|
| PubChem CID | 134321829 |
| Molecular Formula | C31H58FN7O2 |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.46 |
| IUPAC Name | 3,3-diamino-N-[5-butyl-4-[4-(oxan-4-yl)piperazin-1-yl]piperidin-3-yl]-2-[(4R)-4-ethyl-7-fluoro-4-methyl-3,5,6,7-tetrahydro-2H-azocin-2-yl]propanamide |
| SMILES | CCCCC1CNCC(NC(=O)C(C(N)N)C2C[C@](C)(CC)CCC(F)/C=N\2)C1N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C31H58FN7O2/c1-4-6-7-22-19-35-21-26(28(22)39-14-12-38(13-15-39)24-9-16-41-17-10-24)37-30(40)27(29(33)34)25-18-31(3,5-2)11-8-23(32)20-36-25/h20,22-29,35H,4-19,21,33-34H2,1-3H3,(H,37,40)/b36-20-/t22?,23?,25?,26?,27?,28?,31-/m1/s1 |
| InChIKey | PKOMTKFLXIDTLH-YQBZXTBKSA-N |
| XLogP | 2.28 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|