C32H35N5O5 — CID 134321862
1-methoxy-2-[[2-[4-[1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]phenyl]-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-6-yl]oxy]butan-1-ol (PubChem CID 134321862) has the molecular formula C32H35N5O5 and a molecular weight of 569.66 g/mol. Its IUPAC name is 1-methoxy-2-[[2-[4-[1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]phenyl]-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-6-yl]oxy]butan-1-ol.
| Compound Name | 1-methoxy-2-[[2-[4-[1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]phenyl]-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-6-yl]oxy]butan-1-ol |
|---|---|
| PubChem CID | 134321862 |
| Molecular Formula | C32H35N5O5 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 1-methoxy-2-[[2-[4-[1-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]phenyl]-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-6-yl]oxy]butan-1-ol |
| SMILES | CCC(Oc1cc2c3c(c1)nc(-c1ccc(-c4ncn(Cc5ccc(OC)cc5)n4)cc1)n3CCCCO2)C(O)OC |
| InChI | InChI=1S/C32H35N5O5/c1-4-27(32(38)40-3)42-25-17-26-29-28(18-25)41-16-6-5-15-37(29)31(34-26)23-11-9-22(10-12-23)30-33-20-36(35-30)19-21-7-13-24(39-2)14-8-21/h7-14,17-18,20,27,32,38H,4-6,15-16,19H2,1-3H3 |
| InChIKey | KIQZEOQHWNFTPO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|