C16H25FN2 — CID 134321892
(11E)-6-fluoro-2-prop-1-en-2-yl-4,8-diazabicyclo[11.1.1]pentadeca-1(14),11-diene (PubChem CID 134321892) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is (11E)-6-fluoro-2-prop-1-en-2-yl-4,8-diazabicyclo[11.1.1]pentadeca-1(14),11-diene.
| Compound Name | (11E)-6-fluoro-2-prop-1-en-2-yl-4,8-diazabicyclo[11.1.1]pentadeca-1(14),11-diene |
|---|---|
| PubChem CID | 134321892 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (11E)-6-fluoro-2-prop-1-en-2-yl-4,8-diazabicyclo[11.1.1]pentadeca-1(14),11-diene |
| SMILES | C=C(C)C1CNCC(F)CNCC/C=C\C2C=C1C2 |
| InChI | InChI=1S/C16H25FN2/c1-12(2)16-11-19-10-15(17)9-18-6-4-3-5-13-7-14(16)8-13/h3,5,7,13,15-16,18-19H,1,4,6,8-11H2,2H3/b5-3- |
| InChIKey | RTAFAQJYPQMBGY-HYXAFXHYSA-N |
| XLogP | 2.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|