C26H48ClN7O2 — CID 134321913
3,3-diamino-2-(6-chloro-4-azatricyclo[6.4.1.01,8]tridecan-3-yl)-N-[4-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 134321913) has the molecular formula C26H48ClN7O2 and a molecular weight of 526.17 g/mol. Its IUPAC name is 3,3-diamino-2-(6-chloro-4-azatricyclo[6.4.1.01,8]tridecan-3-yl)-N-[4-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-chloro-4-azatricyclo[6.4.1.01,8]tridecan-3-yl)-N-[4-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 134321913 |
| Molecular Formula | C26H48ClN7O2 |
| Molecular Weight | 526.17 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | 3,3-diamino-2-(6-chloro-4-azatricyclo[6.4.1.01,8]tridecan-3-yl)-N-[4-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CN1CCN(C2CCNCC2NC(=O)C(C(N)N)C2CC34CCCCC3(CC(Cl)CN2)C4)CC1CO |
| InChI | InChI=1S/C26H48ClN7O2/c1-33-8-9-34(14-18(33)15-35)21-4-7-30-13-20(21)32-24(36)22(23(28)29)19-11-26-6-3-2-5-25(26,16-26)10-17(27)12-31-19/h17-23,30-31,35H,2-16,28-29H2,1H3,(H,32,36) |
| InChIKey | JWBNDYBLUHYVNU-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|