C27H50FN7O2 — CID 134321914
1-[3-[[3,3-diamino-2-(5-ethyl-3-fluoro-5-methyl-2,3,4,6,7,8-hexahydroazonin-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 134321914) has the molecular formula C27H50FN7O2 and a molecular weight of 523.74 g/mol. Its IUPAC name is 1-[3-[[3,3-diamino-2-(5-ethyl-3-fluoro-5-methyl-2,3,4,6,7,8-hexahydroazonin-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[[3,3-diamino-2-(5-ethyl-3-fluoro-5-methyl-2,3,4,6,7,8-hexahydroazonin-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 134321914 |
| Molecular Formula | C27H50FN7O2 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | 1-[3-[[3,3-diamino-2-(5-ethyl-3-fluoro-5-methyl-2,3,4,6,7,8-hexahydroazonin-9-yl)propanoyl]amino]piperidin-4-yl]-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CCC1(C)CCC/C(C(C(=O)NC2CNCCC2N2CCCC(C(=O)N(C)C)C2)C(N)N)=N\CC(F)C1 |
| InChI | InChI=1S/C27H50FN7O2/c1-5-27(2)11-6-9-20(32-15-19(28)14-27)23(24(29)30)25(36)33-21-16-31-12-10-22(21)35-13-7-8-18(17-35)26(37)34(3)4/h18-19,21-24,31H,5-17,29-30H2,1-4H3,(H,33,36)/b32-20+ |
| InChIKey | QHDTZERRDHTITO-UZWMFBFFSA-N |
| XLogP | 1.26 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|