C18H31FN4O — CID 134321942
2-(5-amino-3-cyclohexyl-3-fluoropiperidin-4-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 134321942) has the molecular formula C18H31FN4O and a molecular weight of 338.47 g/mol. Its IUPAC name is 2-(5-amino-3-cyclohexyl-3-fluoropiperidin-4-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | 2-(5-amino-3-cyclohexyl-3-fluoropiperidin-4-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 134321942 |
| Molecular Formula | C18H31FN4O |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2-(5-amino-3-cyclohexyl-3-fluoropiperidin-4-yl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | NC1CNCC(F)(C2CCCCC2)C1N1CC(=O)N2CCCC2C1 |
| InChI | InChI=1S/C18H31FN4O/c19-18(13-5-2-1-3-6-13)12-21-9-15(20)17(18)22-10-14-7-4-8-23(14)16(24)11-22/h13-15,17,21H,1-12,20H2 |
| InChIKey | JYSFGPZJGULAMS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |