C36H33N3O9S — CID 134321998
3-[5-[2-[[2-(3,4-dimethoxyphenyl)-1,1,2,2-tetrahydroxyethyl]amino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide (PubChem CID 134321998) has the molecular formula C36H33N3O9S and a molecular weight of 683.74 g/mol. Its IUPAC name is 3-[5-[2-[[2-(3,4-dimethoxyphenyl)-1,1,2,2-tetrahydroxyethyl]amino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-[5-[2-[[2-(3,4-dimethoxyphenyl)-1,1,2,2-tetrahydroxyethyl]amino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 134321998 |
| Molecular Formula | C36H33N3O9S |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 683.19 |
| IUPAC Name | 3-[5-[2-[[2-(3,4-dimethoxyphenyl)-1,1,2,2-tetrahydroxyethyl]amino]-2-oxoethyl]-4-oxo-2-[4-(2-phenylethynyl)phenyl]-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1ccc(C(O)(O)C(O)(O)NC(=O)CC2SC(c3ccc(C#Cc4ccccc4)cc3)N(c3cccc(C(N)=O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C36H33N3O9S/c1-47-28-18-17-26(20-29(28)48-2)35(43,44)36(45,46)38-31(40)21-30-33(42)39(27-10-6-9-25(19-27)32(37)41)34(49-30)24-15-13-23(14-16-24)12-11-22-7-4-3-5-8-22/h3-10,13-20,30,34,43-46H,21H2,1-2H3,(H2,37,41)(H,38,40) |
| InChIKey | FSKUBFVDBTXUTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 191.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|