About (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine
(1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine (PubChem CID 134322042) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine.
Molecular Properties
| Compound Name | (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine |
| PubChem CID | 134322042 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine |
| SMILES | C=c1[nH]cc/c1=C(/CCCC=CC)N(C)C |
| InChI | InChI=1S/C14H22N2/c1-5-6-7-8-9-14(16(3)4)13-10-11-15-12(13)2/h5-6,10-11,15H,2,7-9H2,1,3-4H3/b6-5?,14-13+ |
| InChIKey | KYMHLWPMPHMDFJ-QOVKMTANSA-N |
| XLogP | 1.84 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine?
The IUPAC name of (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine (CID 134322042) is (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine.
What is the SMILES notation for (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine?
The canonical SMILES for (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine is C=c1[nH]cc/c1=C(/CCCC=CC)N(C)C.
What is the InChIKey of (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine?
The InChIKey is KYMHLWPMPHMDFJ-QOVKMTANSA-N. The full InChI is InChI=1S/C14H22N2/c1-5-6-7-8-9-14(16(3)4)13-10-11-15-12(13)2/h5-6,10-11,15H,2,7-9H2,1,3-4H3/b6-5?,14-13+.
What are the key properties of (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine?
(1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine has a molecular weight of 218.34 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N,N-dimethyl-1-(2-methylidene-1H-pyrrol-3-ylidene)hept-5-en-1-amine is sourced from PubChem (CID 134322042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).