C17H34N2O — CID 134322296
N,N'-diethyl-N'-[3-[(2Z,4Z)-octa-2,4-dienoxy]propyl]ethane-1,2-diamine (PubChem CID 134322296) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N,N'-diethyl-N'-[3-[(2Z,4Z)-octa-2,4-dienoxy]propyl]ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N'-[3-[(2Z,4Z)-octa-2,4-dienoxy]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134322296 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N,N'-diethyl-N'-[3-[(2Z,4Z)-octa-2,4-dienoxy]propyl]ethane-1,2-diamine |
| SMILES | CCC/C=C\C=C/COCCCN(CC)CCNCC |
| InChI | InChI=1S/C17H34N2O/c1-4-7-8-9-10-11-16-20-17-12-14-19(6-3)15-13-18-5-2/h8-11,18H,4-7,12-17H2,1-3H3/b9-8-,11-10- |
| InChIKey | ONZNTMIYHAIZHK-XESWYYRISA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|