C21H30N4O5S — CID 134322299
tert-butyl N-[(E)-[5-methyl-2,4-dioxo-1-(oxolan-2-ylmethyl)-3-propan-2-ylthieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate (PubChem CID 134322299) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is tert-butyl N-[(E)-[5-methyl-2,4-dioxo-1-(oxolan-2-ylmethyl)-3-propan-2-ylthieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[5-methyl-2,4-dioxo-1-(oxolan-2-ylmethyl)-3-propan-2-ylthieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 134322299 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | tert-butyl N-[(E)-[5-methyl-2,4-dioxo-1-(oxolan-2-ylmethyl)-3-propan-2-ylthieno[2,3-d]pyrimidin-6-yl]methylideneamino]carbamate |
| SMILES | Cc1c(/C=N/NC(=O)OC(C)(C)C)sc2c1c(=O)n(C(C)C)c(=O)n2CC1CCCO1 |
| InChI | InChI=1S/C21H30N4O5S/c1-12(2)25-17(26)16-13(3)15(10-22-23-19(27)30-21(4,5)6)31-18(16)24(20(25)28)11-14-8-7-9-29-14/h10,12,14H,7-9,11H2,1-6H3,(H,23,27)/b22-10+ |
| InChIKey | HACYYQKJCJZLPY-LSHDLFTRSA-N |
| XLogP | 3.15 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|