About methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate
methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate (PubChem CID 134322716) has the molecular formula C18H20FNO2
and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate |
| PubChem CID | 134322716 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=CC(N2CC=C(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C18H20FNO2/c1-22-18(21)15-4-7-17(12-15)20-10-8-14(9-11-20)13-2-5-16(19)6-3-13/h2-3,5-6,8,12,17H,4,7,9-11H2,1H3 |
| InChIKey | QWHKKVFGUIDJAB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate?
The IUPAC name of methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate (CID 134322716) is methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate.
What is the SMILES notation for methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate?
The canonical SMILES for methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate is COC(=O)C1=CC(N2CC=C(c3ccc(F)cc3)CC2)CC1.
What is the InChIKey of methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate?
The InChIKey is QWHKKVFGUIDJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO2/c1-22-18(21)15-4-7-17(12-15)20-10-8-14(9-11-20)13-2-5-16(19)6-3-13/h2-3,5-6,8,12,17H,4,7,9-11H2,1H3.
What are the key properties of methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate?
methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate has a molecular weight of 301.36 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]cyclopentene-1-carboxylate is sourced from PubChem (CID 134322716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).