About 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one
8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 134324128) has the molecular formula C14H11ClN2O
and a molecular weight of 258.71 g/mol. Its IUPAC name is 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one.
Molecular Properties
| Compound Name | 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one |
| PubChem CID | 134324128 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | Cc1nccc2c3ccc(Cl)cc3c(=O)n(C)c12 |
| InChI | InChI=1S/C14H11ClN2O/c1-8-13-11(5-6-16-8)10-4-3-9(15)7-12(10)14(18)17(13)2/h3-7H,1-2H3 |
| InChIKey | PRIMJWQVWAHLDG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one?
The IUPAC name of 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one (CID 134324128) is 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one.
What is the SMILES notation for 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one?
The canonical SMILES for 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one is Cc1nccc2c3ccc(Cl)cc3c(=O)n(C)c12.
What is the InChIKey of 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one?
The InChIKey is PRIMJWQVWAHLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O/c1-8-13-11(5-6-16-8)10-4-3-9(15)7-12(10)14(18)17(13)2/h3-7H,1-2H3.
What are the key properties of 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one?
8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one has a molecular weight of 258.71 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4,5-dimethylbenzo[c][1,7]naphthyridin-6-one is sourced from PubChem (CID 134324128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).