C14H11ClN2O — CID 134324140
8-chloro-5,9-dimethylbenzo[c][1,7]naphthyridin-6-one (PubChem CID 134324140) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 8-chloro-5,9-dimethylbenzo[c][1,7]naphthyridin-6-one.
| Compound Name | 8-chloro-5,9-dimethylbenzo[c][1,7]naphthyridin-6-one |
|---|---|
| PubChem CID | 134324140 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 8-chloro-5,9-dimethylbenzo[c][1,7]naphthyridin-6-one |
| SMILES | Cc1cc2c(cc1Cl)c(=O)n(C)c1cnccc21 |
| InChI | InChI=1S/C14H11ClN2O/c1-8-5-10-9-3-4-16-7-13(9)17(2)14(18)11(10)6-12(8)15/h3-7H,1-2H3 |
| InChIKey | USNXGGPPYMKSAU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|