C24H27F2N3O3 — CID 134324582
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-3-hydroxyoxetane-3-carboxamide (PubChem CID 134324582) has the molecular formula C24H27F2N3O3 and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-3-hydroxyoxetane-3-carboxamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-3-hydroxyoxetane-3-carboxamide |
|---|---|
| PubChem CID | 134324582 |
| Molecular Formula | C24H27F2N3O3 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-3-hydroxyoxetane-3-carboxamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)C1(O)COC1 |
| InChI | InChI=1S/C24H27F2N3O3/c1-4-29(21(30)24(31)12-32-13-24)11-23-9-8-15(22(23,2)3)14-10-18(27-28-20(14)23)19-16(25)6-5-7-17(19)26/h5-7,10,15,31H,4,8-9,11-13H2,1-3H3/t15-,23-/m0/s1 |
| InChIKey | ZVVWIZQVPJILKS-WNSKOXEYSA-N |
| XLogP | 3.19 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |