C25H27F2N5O — CID 134324591
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 134324591) has the molecular formula C25H27F2N5O and a molecular weight of 451.52 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 134324591 |
| Molecular Formula | C25H27F2N5O |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C25H27F2N5O/c1-5-32(23(33)20-11-14(2)28-30-20)13-25-10-9-16(24(25,3)4)15-12-19(29-31-22(15)25)21-17(26)7-6-8-18(21)27/h6-8,11-12,16H,5,9-10,13H2,1-4H3,(H,28,30)/t16-,25-/m0/s1 |
| InChIKey | XMFRDYPSBLPLSR-LMKMVOKYSA-N |
| XLogP | 4.77 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |