C26H31F2N5O2 — CID 134324601
2-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-N-ethylpyrrolidine-1,2-dicarboxamide (PubChem CID 134324601) has the molecular formula C26H31F2N5O2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 2-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-N-ethylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-N-ethylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 134324601 |
| Molecular Formula | C26H31F2N5O2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-N-ethylpyrrolidine-1,2-dicarboxamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)C1CCCN1C(N)=O |
| InChI | InChI=1S/C26H31F2N5O2/c1-4-32(23(34)20-9-6-12-33(20)24(29)35)14-26-11-10-16(25(26,2)3)15-13-19(30-31-22(15)26)21-17(27)7-5-8-18(21)28/h5,7-8,13,16,20H,4,6,9-12,14H2,1-3H3,(H2,29,35)/t16-,20?,26-/m0/s1 |
| InChIKey | HINFFYKJNINJIQ-SAGNJFTKSA-N |
| XLogP | 3.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |